About 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide
3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide (PubChem CID 10749998) has the molecular formula C10H16OS
and a molecular weight of 184.30 g/mol. Its IUPAC name is 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide.
Molecular Properties
| Compound Name | 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide |
| PubChem CID | 10749998 |
| Molecular Formula | C10H16OS |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide |
| SMILES | CC(C)=CCCC1=CCS(=O)C1 |
| InChI | InChI=1S/C10H16OS/c1-9(2)4-3-5-10-6-7-12(11)8-10/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | QSTPEMPZTSYXQL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide?
The IUPAC name of 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide (CID 10749998) is 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide.
What is the SMILES notation for 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide?
The canonical SMILES for 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide is CC(C)=CCCC1=CCS(=O)C1.
What is the InChIKey of 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide?
The InChIKey is QSTPEMPZTSYXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16OS/c1-9(2)4-3-5-10-6-7-12(11)8-10/h4,6H,3,5,7-8H2,1-2H3.
What are the key properties of 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide?
3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide has a molecular weight of 184.30 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methylpent-3-enyl)-2,5-dihydrothiophene 1-oxide is sourced from PubChem (CID 10749998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).