C9H10O4 — CID 10750012
4-hydroxy-2,3-dimethoxy-4-(3,3,3-trideuterioprop-1-ynyl)cyclobut-2-en-1-one (PubChem CID 10750012) has the molecular formula C9H10O4 and a molecular weight of 185.19 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethoxy-4-(3,3,3-trideuterioprop-1-ynyl)cyclobut-2-en-1-one.
| Compound Name | 4-hydroxy-2,3-dimethoxy-4-(3,3,3-trideuterioprop-1-ynyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10750012 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 4-hydroxy-2,3-dimethoxy-4-(3,3,3-trideuterioprop-1-ynyl)cyclobut-2-en-1-one |
| SMILES | [2H]C([2H])([2H])C#CC1(O)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C9H10O4/c1-4-5-9(11)7(10)6(12-2)8(9)13-3/h11H,1-3H3/i1D3 |
| InChIKey | LHXPDSJTXXKULA-FIBGUPNXSA-N |
| XLogP | -0.17 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|