About [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate
[(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate (PubChem CID 10750036) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate.
Analyze [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate?
The IUPAC name of [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate (CID 10750036) is [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate.
What is the SMILES notation for [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate?
The canonical SMILES for [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate is CC(=O)O[C@H]1[C@@H](O)C=CC(=O)[C@@H]1O.
What is the InChIKey of [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate?
The InChIKey is FGXMMKRCYGHJOE-FXQIFTODSA-N. The full InChI is InChI=1S/C8H10O5/c1-4(9)13-8-6(11)3-2-5(10)7(8)12/h2-3,6-8,11-12H,1H3/t6-,7-,8-/m0/s1.
What are the key properties of [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate?
[(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate has a molecular weight of 186.16 g/mol, XLogP of -1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,6R)-2,6-dihydroxy-5-oxocyclohex-3-en-1-yl] acetate is sourced from PubChem (CID 10750036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).