About 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one
4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 107501039) has the molecular formula C13H13Cl2N3O2
and a molecular weight of 314.17 g/mol. Its IUPAC name is 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
| PubChem CID | 107501039 |
| Molecular Formula | C13H13Cl2N3O2 |
| Molecular Weight | 314.17 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1nc(Oc2cc(Cl)c(Cl)cc2N)cc(=O)[nH]1 |
| InChI | InChI=1S/C13H13Cl2N3O2/c1-6(2)13-17-11(19)5-12(18-13)20-10-4-8(15)7(14)3-9(10)16/h3-6H,16H2,1-2H3,(H,17,18,19) |
| InChIKey | XGZAUCKSLXEVHE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one?
The IUPAC name of 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one (CID 107501039) is 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one.
What is the SMILES notation for 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one?
The canonical SMILES for 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one is CC(C)c1nc(Oc2cc(Cl)c(Cl)cc2N)cc(=O)[nH]1.
What is the InChIKey of 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one?
The InChIKey is XGZAUCKSLXEVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13Cl2N3O2/c1-6(2)13-17-11(19)5-12(18-13)20-10-4-8(15)7(14)3-9(10)16/h3-6H,16H2,1-2H3,(H,17,18,19).
What are the key properties of 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one?
4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one has a molecular weight of 314.17 g/mol, XLogP of 3.57, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4,5-dichlorophenoxy)-2-propan-2-yl-1H-pyrimidin-6-one is sourced from PubChem (CID 107501039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).