C12H16N2 — CID 10750137
6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline (PubChem CID 10750137) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline.
| Compound Name | 6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 10750137 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 6,6a,7,8,9,10-hexahydro-5H-pyrido[1,2-a]quinoxaline |
| SMILES | c1ccc2c(c1)NCC1CCCCN21 |
| InChI | InChI=1S/C12H16N2/c1-2-7-12-11(6-1)13-9-10-5-3-4-8-14(10)12/h1-2,6-7,10,13H,3-5,8-9H2 |
| InChIKey | YNWGNIXGOYARFJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |