2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid

C9H9N3O2 — CID 10750225

IUPAC2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid
SMILESCc1cncc2nc(CC(=O)O)cn12
InChIInChI=1S/C9H9N3O2/c1-6-3-10-4-8-11-7(2-9(13)14)5-12(6)8/h3-5H,2H2,1H3,(H,13,14)
InChIKeyVWFKATSUEVVSCS-UHFFFAOYSA-N
MW191.19 g/mol
LogP0.66
Rot. Bonds2

About 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid

2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid (PubChem CID 10750225) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid
PubChem CID10750225
Molecular FormulaC9H9N3O2
Molecular Weight191.19 g/mol
Exact Mass191.07
IUPAC Name2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid
SMILESCc1cncc2nc(CC(=O)O)cn12
InChIInChI=1S/C9H9N3O2/c1-6-3-10-4-8-11-7(2-9(13)14)5-12(6)8/h3-5H,2H2,1H3,(H,13,14)
InChIKeyVWFKATSUEVVSCS-UHFFFAOYSA-N
XLogP0.66
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.19
LogP ≤ 50.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid?
The IUPAC name of 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid (CID 10750225) is 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid.
What is the SMILES notation for 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid?
The canonical SMILES for 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid is Cc1cncc2nc(CC(=O)O)cn12.
What is the InChIKey of 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid?
The InChIKey is VWFKATSUEVVSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-6-3-10-4-8-11-7(2-9(13)14)5-12(6)8/h3-5H,2H2,1H3,(H,13,14).
What are the key properties of 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid?
2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid has a molecular weight of 191.19 g/mol, XLogP of 0.66, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methylimidazo[1,2-a]pyrazin-2-yl)acetic acid is sourced from PubChem (CID 10750225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).