(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine

C17H22N2O — CID 107503067

IUPAC(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine
SMILESCc1cc(C(N)c2ccccc2OC(C)C)cc(C)n1
InChIInChI=1S/C17H22N2O/c1-11(2)20-16-8-6-5-7-15(16)17(18)14-9-12(3)19-13(4)10-14/h5-11,17H,18H2,1-4H3
InChIKeyVZIGFBKZBCKJNC-UHFFFAOYSA-N
MW270.38 g/mol
LogP3.53
Rot. Bonds4

About (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine

(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine (PubChem CID 107503067) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine.

Molecular Properties

Compound Name(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine
PubChem CID107503067
Molecular FormulaC17H22N2O
Molecular Weight270.38 g/mol
Exact Mass270.17
IUPAC Name(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine
SMILESCc1cc(C(N)c2ccccc2OC(C)C)cc(C)n1
InChIInChI=1S/C17H22N2O/c1-11(2)20-16-8-6-5-7-15(16)17(18)14-9-12(3)19-13(4)10-14/h5-11,17H,18H2,1-4H3
InChIKeyVZIGFBKZBCKJNC-UHFFFAOYSA-N
XLogP3.53
TPSA48.14 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.38
LogP ≤ 53.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(4-iodophenyl)-(2-propan-2-yloxyphenyl)methanamine
CID 105018125
(2-chlorofuran-3-yl)-(2-propan-2-yloxyphenyl)methanamine
CID 106692739
(2-chloro-3-methylphenyl)-(2-propan-2-yloxyphenyl)methanamine
CID 105018279
(1,5-dimethylpyrazol-4-yl)-(2-propan-2-yloxyphenyl)methanamine
CID 105170979
(2-cyclobutylphenyl)-(2,6-dimethyl-4-pyridinyl)methanamine
CID 107503001
(4-chloro-2,5-difluorophenyl)-(2-propan-2-yloxyphenyl)methanamine
CID 105018161
[2-(difluoromethoxy)phenyl]-(3-methylphenyl)methanamine
CID 115790299
(1S)-1-(2-propan-2-yloxyphenyl)pentan-1-amine
CID 171231533
(1R)-1-(2-propan-2-yloxyphenyl)butane-1,4-diamine
CID 171211917
(R)-cyclopropyl-(2-propan-2-yloxyphenyl)methanamine;hydrochloride
CID 171211944
(1S)-3-fluoro-1-(2-propan-2-yloxyphenyl)propan-1-amine
CID 171231545
(2-bromo-3,4-difluorophenyl)-(2-propan-2-yloxyphenyl)methanamine
CID 107538588

Frequently Asked Questions

What is the IUPAC name of (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine?
The IUPAC name of (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine (CID 107503067) is (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine.
What is the SMILES notation for (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine?
The canonical SMILES for (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine is Cc1cc(C(N)c2ccccc2OC(C)C)cc(C)n1.
What is the InChIKey of (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine?
The InChIKey is VZIGFBKZBCKJNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O/c1-11(2)20-16-8-6-5-7-15(16)17(18)14-9-12(3)19-13(4)10-14/h5-11,17H,18H2,1-4H3.
What are the key properties of (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine?
(2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine has a molecular weight of 270.38 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethyl-4-pyridinyl)-(2-propan-2-yloxyphenyl)methanamine is sourced from PubChem (CID 107503067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).