C10H12O4 — CID 10750377
2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione (PubChem CID 10750377) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione.
| Compound Name | 2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione |
|---|---|
| PubChem CID | 10750377 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-ethenyl-6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione |
| SMILES | C=CC1CC12C(=O)OC(C)(C)OC2=O |
| InChI | InChI=1S/C10H12O4/c1-4-6-5-10(6)7(11)13-9(2,3)14-8(10)12/h4,6H,1,5H2,2-3H3 |
| InChIKey | LHOWRYQIMFIXLH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|