About 1-N,5-N-dimethoxycyclooctane-1,5-diimine
1-N,5-N-dimethoxycyclooctane-1,5-diimine (PubChem CID 10750478) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-N,5-N-dimethoxycyclooctane-1,5-diimine.
Molecular Properties
| Compound Name | 1-N,5-N-dimethoxycyclooctane-1,5-diimine |
| PubChem CID | 10750478 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-N,5-N-dimethoxycyclooctane-1,5-diimine |
| SMILES | CON=C1CCCC(=NOC)CCC1 |
| InChI | InChI=1S/C10H18N2O2/c1-13-11-9-5-3-7-10(12-14-2)8-4-6-9/h3-8H2,1-2H3/b11-9-,12-10+ |
| InChIKey | HOWHXNDBFZFCEL-DSOJMZEYSA-N |
| XLogP | 2.35 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N,5-N-dimethoxycyclooctane-1,5-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,5-N-dimethoxycyclooctane-1,5-diimine?
The IUPAC name of 1-N,5-N-dimethoxycyclooctane-1,5-diimine (CID 10750478) is 1-N,5-N-dimethoxycyclooctane-1,5-diimine.
What is the SMILES notation for 1-N,5-N-dimethoxycyclooctane-1,5-diimine?
The canonical SMILES for 1-N,5-N-dimethoxycyclooctane-1,5-diimine is CON=C1CCCC(=NOC)CCC1.
What is the InChIKey of 1-N,5-N-dimethoxycyclooctane-1,5-diimine?
The InChIKey is HOWHXNDBFZFCEL-DSOJMZEYSA-N. The full InChI is InChI=1S/C10H18N2O2/c1-13-11-9-5-3-7-10(12-14-2)8-4-6-9/h3-8H2,1-2H3/b11-9-,12-10+.
What are the key properties of 1-N,5-N-dimethoxycyclooctane-1,5-diimine?
1-N,5-N-dimethoxycyclooctane-1,5-diimine has a molecular weight of 198.27 g/mol, XLogP of 2.35, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,5-N-dimethoxycyclooctane-1,5-diimine is sourced from PubChem (CID 10750478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).