C12H14BrN3O — CID 107504907
[(3-bromofuran-2-yl)-(2,6-dimethyl-4-pyridinyl)methyl]hydrazine (PubChem CID 107504907) has the molecular formula C12H14BrN3O and a molecular weight of 296.17 g/mol. Its IUPAC name is [(3-bromofuran-2-yl)-(2,6-dimethyl-4-pyridinyl)methyl]hydrazine.
| Compound Name | [(3-bromofuran-2-yl)-(2,6-dimethyl-4-pyridinyl)methyl]hydrazine |
|---|---|
| PubChem CID | 107504907 |
| Molecular Formula | C12H14BrN3O |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | [(3-bromofuran-2-yl)-(2,6-dimethyl-4-pyridinyl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2occc2Br)cc(C)n1 |
| InChI | InChI=1S/C12H14BrN3O/c1-7-5-9(6-8(2)15-7)11(16-14)12-10(13)3-4-17-12/h3-6,11,16H,14H2,1-2H3 |
| InChIKey | JBOLLGZBIHATGC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|