C10H12ClNO — CID 10750570
N-[1-(4-chlorophenyl)ethyl]-2,2,2-trideuterioacetamide (PubChem CID 10750570) has the molecular formula C10H12ClNO and a molecular weight of 200.68 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-2,2,2-trideuterioacetamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-2,2,2-trideuterioacetamide |
|---|---|
| PubChem CID | 10750570 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 200.68 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-2,2,2-trideuterioacetamide |
| SMILES | [2H]C([2H])([2H])C(=O)NC(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H12ClNO/c1-7(12-8(2)13)9-3-5-10(11)6-4-9/h3-7H,1-2H3,(H,12,13)/i2D3 |
| InChIKey | HGKOQCMPYYZGCI-BMSJAHLVSA-N |
| XLogP | 2.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |