C10H19NO4 — CID 107507511
1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-methoxypropan-2-one (PubChem CID 107507511) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-methoxypropan-2-one.
| Compound Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-methoxypropan-2-one |
|---|---|
| PubChem CID | 107507511 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]-3-methoxypropan-2-one |
| SMILES | COCC(=O)CN1CC(CO)OCC1C |
| InChI | InChI=1S/C10H19NO4/c1-8-6-15-10(5-12)4-11(8)3-9(13)7-14-2/h8,10,12H,3-7H2,1-2H3 |
| InChIKey | VZQUDVNUNPOFEN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |