About (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one
(1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one (PubChem CID 10750808) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one.
Molecular Properties
| Compound Name | (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one |
| PubChem CID | 10750808 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one |
| SMILES | C=C1CCC(=O)CCC[C@@H]2[C@@H]1CC2(C)C |
| InChI | InChI=1S/C14H22O/c1-10-7-8-11(15)5-4-6-13-12(10)9-14(13,2)3/h12-13H,1,4-9H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | SVROROODYLVLSH-CHWSQXEVSA-N |
| XLogP | 3.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one?
The IUPAC name of (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one (CID 10750808) is (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one.
What is the SMILES notation for (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one?
The canonical SMILES for (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one is C=C1CCC(=O)CCC[C@@H]2[C@@H]1CC2(C)C.
What is the InChIKey of (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one?
The InChIKey is SVROROODYLVLSH-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H22O/c1-10-7-8-11(15)5-4-6-13-12(10)9-14(13,2)3/h12-13H,1,4-9H2,2-3H3/t12-,13-/m1/s1.
What are the key properties of (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one?
(1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one has a molecular weight of 206.33 g/mol, XLogP of 3.74, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,9R)-10,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one is sourced from PubChem (CID 10750808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).