C10H16N2O2S — CID 107508930
2-(diethylamino)-4-(methoxymethyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 107508930) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 2-(diethylamino)-4-(methoxymethyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(diethylamino)-4-(methoxymethyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 107508930 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-(diethylamino)-4-(methoxymethyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CCN(CC)c1nc(COC)c(C=O)s1 |
| InChI | InChI=1S/C10H16N2O2S/c1-4-12(5-2)10-11-8(7-14-3)9(6-13)15-10/h6H,4-5,7H2,1-3H3 |
| InChIKey | DLGSMWICGMMOLL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|