C15H28N4OS — CID 107509491
N-[[4-(methoxymethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 107509491) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-(methoxymethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 107509491 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-[[4-(methoxymethyl)-2-(4-methyl-1,4-diazepan-1-yl)-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(N2CCCN(C)CC2)nc1COC |
| InChI | InChI=1S/C15H28N4OS/c1-4-6-16-11-14-13(12-20-3)17-15(21-14)19-8-5-7-18(2)9-10-19/h16H,4-12H2,1-3H3 |
| InChIKey | RELZDGGQNHQWSC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|