About (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine
(E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine (PubChem CID 10750987) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine |
| PubChem CID | 10750987 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine |
| SMILES | C=CCN(CC=C)C/C=C/C(OC)OC |
| InChI | InChI=1S/C12H21NO2/c1-5-9-13(10-6-2)11-7-8-12(14-3)15-4/h5-8,12H,1-2,9-11H2,3-4H3/b8-7+ |
| InChIKey | PDBGWDVMGCICEZ-BQYQJAHWSA-N |
| XLogP | 1.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The IUPAC name of (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine (CID 10750987) is (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine.
What is the SMILES notation for (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The canonical SMILES for (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine is C=CCN(CC=C)C/C=C/C(OC)OC.
What is the InChIKey of (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The InChIKey is PDBGWDVMGCICEZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C12H21NO2/c1-5-9-13(10-6-2)11-7-8-12(14-3)15-4/h5-8,12H,1-2,9-11H2,3-4H3/b8-7+.
What are the key properties of (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine?
(E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine has a molecular weight of 211.30 g/mol, XLogP of 1.84, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine is sourced from PubChem (CID 10750987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).