C12H21NO2 — CID 10750987
(E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine (PubChem CID 10750987) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine.
| Compound Name | (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine |
|---|---|
| PubChem CID | 10750987 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (E)-4,4-dimethoxy-N,N-bis(prop-2-enyl)but-2-en-1-amine |
| SMILES | C=CCN(CC=C)C/C=C/C(OC)OC |
| InChI | InChI=1S/C12H21NO2/c1-5-9-13(10-6-2)11-7-8-12(14-3)15-4/h5-8,12H,1-2,9-11H2,3-4H3/b8-7+ |
| InChIKey | PDBGWDVMGCICEZ-BQYQJAHWSA-N |
| XLogP | 1.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|