C10H13F2NOS — CID 107511220
1-(2,4-difluorophenyl)sulfanyl-3-methoxypropan-2-amine (PubChem CID 107511220) has the molecular formula C10H13F2NOS and a molecular weight of 233.28 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)sulfanyl-3-methoxypropan-2-amine.
| Compound Name | 1-(2,4-difluorophenyl)sulfanyl-3-methoxypropan-2-amine |
|---|---|
| PubChem CID | 107511220 |
| Molecular Formula | C10H13F2NOS |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 1-(2,4-difluorophenyl)sulfanyl-3-methoxypropan-2-amine |
| SMILES | COCC(N)CSc1ccc(F)cc1F |
| InChI | InChI=1S/C10H13F2NOS/c1-14-5-8(13)6-15-10-3-2-7(11)4-9(10)12/h2-4,8H,5-6,13H2,1H3 |
| InChIKey | VMNJGQKTOPJFKB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |