C9H15N3OS — CID 107511460
1-methoxy-3-(5-methylpyrimidin-2-yl)sulfanylpropan-2-amine (PubChem CID 107511460) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 1-methoxy-3-(5-methylpyrimidin-2-yl)sulfanylpropan-2-amine.
| Compound Name | 1-methoxy-3-(5-methylpyrimidin-2-yl)sulfanylpropan-2-amine |
|---|---|
| PubChem CID | 107511460 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 1-methoxy-3-(5-methylpyrimidin-2-yl)sulfanylpropan-2-amine |
| SMILES | COCC(N)CSc1ncc(C)cn1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-3-11-9(12-4-7)14-6-8(10)5-13-2/h3-4,8H,5-6,10H2,1-2H3 |
| InChIKey | BKGGKRGKTRTEOJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |