About 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine
3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine (PubChem CID 107511715) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine |
| PubChem CID | 107511715 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine |
| SMILES | COCc1cnc2cc(C)cc(C)n12 |
| InChI | InChI=1S/C11H14N2O/c1-8-4-9(2)13-10(7-14-3)6-12-11(13)5-8/h4-6H,7H2,1-3H3 |
| InChIKey | YEVHDAYAWPBFMH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine?
The IUPAC name of 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine (CID 107511715) is 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine.
What is the SMILES notation for 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine?
The canonical SMILES for 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine is COCc1cnc2cc(C)cc(C)n12.
What is the InChIKey of 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine?
The InChIKey is YEVHDAYAWPBFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-8-4-9(2)13-10(7-14-3)6-12-11(13)5-8/h4-6H,7H2,1-3H3.
What are the key properties of 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine?
3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine has a molecular weight of 190.25 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methoxymethyl)-5,7-dimethylimidazo[1,2-a]pyridine is sourced from PubChem (CID 107511715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).