C9H15NO2S — CID 107511985
4-(methoxymethyl)-2-(2-methoxypropyl)-1,3-thiazole (PubChem CID 107511985) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 4-(methoxymethyl)-2-(2-methoxypropyl)-1,3-thiazole.
| Compound Name | 4-(methoxymethyl)-2-(2-methoxypropyl)-1,3-thiazole |
|---|---|
| PubChem CID | 107511985 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 4-(methoxymethyl)-2-(2-methoxypropyl)-1,3-thiazole |
| SMILES | COCc1csc(CC(C)OC)n1 |
| InChI | InChI=1S/C9H15NO2S/c1-7(12-3)4-9-10-8(5-11-2)6-13-9/h6-7H,4-5H2,1-3H3 |
| InChIKey | NYKUDJSLVDHMGQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |