C13H12O3 — CID 10751199
3,5-dimethyl-2,3-dihydrofuro[3,2-g]chromen-7-one (PubChem CID 10751199) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is 3,5-dimethyl-2,3-dihydrofuro[3,2-g]chromen-7-one.
| Compound Name | 3,5-dimethyl-2,3-dihydrofuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 10751199 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3,5-dimethyl-2,3-dihydrofuro[3,2-g]chromen-7-one |
| SMILES | Cc1cc(=O)oc2cc3c(cc12)C(C)CO3 |
| InChI | InChI=1S/C13H12O3/c1-7-3-13(14)16-12-5-11-10(4-9(7)12)8(2)6-15-11/h3-5,8H,6H2,1-2H3 |
| InChIKey | CWRJGLSDXVQPQV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|