C15H19F2NO — CID 107512350
1-(2,3-difluoro-4-methylphenyl)-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol (PubChem CID 107512350) has the molecular formula C15H19F2NO and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol |
|---|---|
| PubChem CID | 107512350 |
| Molecular Formula | C15H19F2NO |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-ol |
| SMILES | Cc1ccc(C2(O)CCN3CCCCC32)c(F)c1F |
| InChI | InChI=1S/C15H19F2NO/c1-10-5-6-11(14(17)13(10)16)15(19)7-9-18-8-3-2-4-12(15)18/h5-6,12,19H,2-4,7-9H2,1H3 |
| InChIKey | YJWKWCSVZHZRSI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |