C14H13F2NO — CID 107512866
1-(2,3-difluoro-4-methylphenyl)-2-pyridin-3-ylethanol (PubChem CID 107512866) has the molecular formula C14H13F2NO and a molecular weight of 249.26 g/mol. Its IUPAC name is 1-(2,3-difluoro-4-methylphenyl)-2-pyridin-3-ylethanol.
| Compound Name | 1-(2,3-difluoro-4-methylphenyl)-2-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 107512866 |
| Molecular Formula | C14H13F2NO |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(2,3-difluoro-4-methylphenyl)-2-pyridin-3-ylethanol |
| SMILES | Cc1ccc(C(O)Cc2cccnc2)c(F)c1F |
| InChI | InChI=1S/C14H13F2NO/c1-9-4-5-11(14(16)13(9)15)12(18)7-10-3-2-6-17-8-10/h2-6,8,12,18H,7H2,1H3 |
| InChIKey | OIKKKGJSHJNMAY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |