C9H19N2O2P — CID 10751287
2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid (PubChem CID 10751287) has the molecular formula C9H19N2O2P and a molecular weight of 218.24 g/mol. Its IUPAC name is 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid.
| Compound Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
|---|---|
| PubChem CID | 10751287 |
| Molecular Formula | C9H19N2O2P |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 2-cyanoethoxy-N,N-di(propan-2-yl)phosphonamidous acid |
| SMILES | CC(C)N(C(C)C)P(O)OCCC#N |
| InChI | InChI=1S/C9H19N2O2P/c1-8(2)11(9(3)4)14(12)13-7-5-6-10/h8-9,12H,5,7H2,1-4H3 |
| InChIKey | FINYOTLDIHYWPR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|