About 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione
5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione (PubChem CID 10751342) has the molecular formula C12H13NO3
and a molecular weight of 219.24 g/mol. Its IUPAC name is 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione.
Molecular Properties
| Compound Name | 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione |
| PubChem CID | 10751342 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione |
| SMILES | COC1=C(C)C(=O)c2[nH]c(C)c(C)c2C1=O |
| InChI | InChI=1S/C12H13NO3/c1-5-7(3)13-9-8(5)11(15)12(16-4)6(2)10(9)14/h13H,1-4H3 |
| InChIKey | ARTJZDBJYHBNRU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione?
The IUPAC name of 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione (CID 10751342) is 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione.
What is the SMILES notation for 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione?
The canonical SMILES for 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione is COC1=C(C)C(=O)c2[nH]c(C)c(C)c2C1=O.
What is the InChIKey of 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione?
The InChIKey is ARTJZDBJYHBNRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-5-7(3)13-9-8(5)11(15)12(16-4)6(2)10(9)14/h13H,1-4H3.
What are the key properties of 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione?
5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione has a molecular weight of 219.24 g/mol, XLogP of 1.93, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,3,6-trimethyl-1H-indole-4,7-dione is sourced from PubChem (CID 10751342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).