About (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine
(2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine (PubChem CID 10751346) has the molecular formula C10H21NO4
and a molecular weight of 219.28 g/mol. Its IUPAC name is (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine.
Molecular Properties
| Compound Name | (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine |
| PubChem CID | 10751346 |
| Molecular Formula | C10H21NO4 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine |
| SMILES | COCOC[C@H]1CC[C@H](COCOC)N1 |
| InChI | InChI=1S/C10H21NO4/c1-12-7-14-5-9-3-4-10(11-9)6-15-8-13-2/h9-11H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | AZSOHULVQDDQGO-NXEZZACHSA-N |
| XLogP | 0.35 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine?
The IUPAC name of (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine (CID 10751346) is (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine.
What is the SMILES notation for (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine?
The canonical SMILES for (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine is COCOC[C@H]1CC[C@H](COCOC)N1.
What is the InChIKey of (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine?
The InChIKey is AZSOHULVQDDQGO-NXEZZACHSA-N. The full InChI is InChI=1S/C10H21NO4/c1-12-7-14-5-9-3-4-10(11-9)6-15-8-13-2/h9-11H,3-8H2,1-2H3/t9-,10-/m1/s1.
What are the key properties of (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine?
(2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine has a molecular weight of 219.28 g/mol, XLogP of 0.35, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-bis(methoxymethoxymethyl)pyrrolidine is sourced from PubChem (CID 10751346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).