C15H21F2N — CID 107513534
2-tert-butyl-2-(2,3-difluoro-4-methylphenyl)pyrrolidine (PubChem CID 107513534) has the molecular formula C15H21F2N and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-tert-butyl-2-(2,3-difluoro-4-methylphenyl)pyrrolidine.
| Compound Name | 2-tert-butyl-2-(2,3-difluoro-4-methylphenyl)pyrrolidine |
|---|---|
| PubChem CID | 107513534 |
| Molecular Formula | C15H21F2N |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-tert-butyl-2-(2,3-difluoro-4-methylphenyl)pyrrolidine |
| SMILES | Cc1ccc(C2(C(C)(C)C)CCCN2)c(F)c1F |
| InChI | InChI=1S/C15H21F2N/c1-10-6-7-11(13(17)12(10)16)15(14(2,3)4)8-5-9-18-15/h6-7,18H,5,8-9H2,1-4H3 |
| InChIKey | FFSCIRYMSSLCMM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |