About 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride
1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride (PubChem CID 10751372) has the molecular formula C9H14ClNO3
and a molecular weight of 219.67 g/mol. Its IUPAC name is 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride.
Molecular Properties
| Compound Name | 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride |
| PubChem CID | 10751372 |
| Molecular Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride |
| SMILES | CC[n+]1c(C)cc(O)c(O)c1CO.[Cl-] |
| InChI | InChI=1S/C9H13NO3.ClH/c1-3-10-6(2)4-8(12)9(13)7(10)5-11;/h4,11,13H,3,5H2,1-2H3;1H |
| InChIKey | GLEBEWUWFKPXDK-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride?
The IUPAC name of 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride (CID 10751372) is 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride.
What is the SMILES notation for 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride?
The canonical SMILES for 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride is CC[n+]1c(C)cc(O)c(O)c1CO.[Cl-].
What is the InChIKey of 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride?
The InChIKey is GLEBEWUWFKPXDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3.ClH/c1-3-10-6(2)4-8(12)9(13)7(10)5-11;/h4,11,13H,3,5H2,1-2H3;1H.
What are the key properties of 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride?
1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride has a molecular weight of 219.67 g/mol, XLogP of -2.79, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-(hydroxymethyl)-6-methylpyridin-1-ium-3,4-diol chloride is sourced from PubChem (CID 10751372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).