About [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine
[4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine (PubChem CID 107514718) has the molecular formula C18H27F2N
and a molecular weight of 295.42 g/mol. Its IUPAC name is [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine |
| PubChem CID | 107514718 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine |
| SMILES | Cc1ccc(C2CC(C(C)(C)C)CCC2CN)c(F)c1F |
| InChI | InChI=1S/C18H27F2N/c1-11-5-8-14(17(20)16(11)19)15-9-13(18(2,3)4)7-6-12(15)10-21/h5,8,12-13,15H,6-7,9-10,21H2,1-4H3 |
| InChIKey | DISDTUAIUAAPRS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine?
The IUPAC name of [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine (CID 107514718) is [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine.
What is the SMILES notation for [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine?
The canonical SMILES for [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine is Cc1ccc(C2CC(C(C)(C)C)CCC2CN)c(F)c1F.
What is the InChIKey of [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine?
The InChIKey is DISDTUAIUAAPRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27F2N/c1-11-5-8-14(17(20)16(11)19)15-9-13(18(2,3)4)7-6-12(15)10-21/h5,8,12-13,15H,6-7,9-10,21H2,1-4H3.
What are the key properties of [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine?
[4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine has a molecular weight of 295.42 g/mol, XLogP of 4.78, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-2-(2,3-difluoro-4-methylphenyl)cyclohexyl]methanamine is sourced from PubChem (CID 107514718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).