About 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid
5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid (PubChem CID 107515625) has the molecular formula C13H11BrO2S
and a molecular weight of 311.20 g/mol. Its IUPAC name is 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid.
Molecular Properties
| Compound Name | 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid |
| PubChem CID | 107515625 |
| Molecular Formula | C13H11BrO2S |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid |
| SMILES | Cc1cc(C)c(-c2cscc2Br)cc1C(=O)O |
| InChI | InChI=1S/C13H11BrO2S/c1-7-3-8(2)10(13(15)16)4-9(7)11-5-17-6-12(11)14/h3-6H,1-2H3,(H,15,16) |
| InChIKey | WIDJGARXECYPJW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid?
The IUPAC name of 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid (CID 107515625) is 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid.
What is the SMILES notation for 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid?
The canonical SMILES for 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid is Cc1cc(C)c(-c2cscc2Br)cc1C(=O)O.
What is the InChIKey of 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid?
The InChIKey is WIDJGARXECYPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO2S/c1-7-3-8(2)10(13(15)16)4-9(7)11-5-17-6-12(11)14/h3-6H,1-2H3,(H,15,16).
What are the key properties of 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid?
5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid has a molecular weight of 311.20 g/mol, XLogP of 4.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-bromothiophen-3-yl)-2,4-dimethylbenzoic acid is sourced from PubChem (CID 107515625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).