methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate

C13H20O3 — CID 10751618

IUPACmethyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate
SMILESCOC(=O)CCC1C(C)=CC(=O)CC1(C)C
InChIInChI=1S/C13H20O3/c1-9-7-10(14)8-13(2,3)11(9)5-6-12(15)16-4/h7,11H,5-6,8H2,1-4H3
InChIKeySGRHKYQPHXHOGC-UHFFFAOYSA-N
MW224.30 g/mol
LogP2.50
Rot. Bonds3

About methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate

methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate (PubChem CID 10751618) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate.

Molecular Properties

Compound Namemethyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate
PubChem CID10751618
Molecular FormulaC13H20O3
Molecular Weight224.30 g/mol
Exact Mass224.14
IUPAC Namemethyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate
SMILESCOC(=O)CCC1C(C)=CC(=O)CC1(C)C
InChIInChI=1S/C13H20O3/c1-9-7-10(14)8-13(2,3)11(9)5-6-12(15)16-4/h7,11H,5-6,8H2,1-4H3
InChIKeySGRHKYQPHXHOGC-UHFFFAOYSA-N
XLogP2.50
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 52.50
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate?
The IUPAC name of methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate (CID 10751618) is methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate.
What is the SMILES notation for methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate?
The canonical SMILES for methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate is COC(=O)CCC1C(C)=CC(=O)CC1(C)C.
What is the InChIKey of methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate?
The InChIKey is SGRHKYQPHXHOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-9-7-10(14)8-13(2,3)11(9)5-6-12(15)16-4/h7,11H,5-6,8H2,1-4H3.
What are the key properties of methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate?
methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate has a molecular weight of 224.30 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)propanoate is sourced from PubChem (CID 10751618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).