C16H16O — CID 10751625
(1R,2S,3S,7S,9R,10S)-17-oxahexacyclo[8.6.1.02,9.03,7.04,7.011,16]heptadeca-11,13,15-triene (PubChem CID 10751625) has the molecular formula C16H16O and a molecular weight of 224.30 g/mol. Its IUPAC name is (1R,2S,3S,7S,9R,10S)-17-oxahexacyclo[8.6.1.02,9.03,7.04,7.011,16]heptadeca-11,13,15-triene.
| Compound Name | (1R,2S,3S,7S,9R,10S)-17-oxahexacyclo[8.6.1.02,9.03,7.04,7.011,16]heptadeca-11,13,15-triene |
|---|---|
| PubChem CID | 10751625 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (1R,2S,3S,7S,9R,10S)-17-oxahexacyclo[8.6.1.02,9.03,7.04,7.011,16]heptadeca-11,13,15-triene |
| SMILES | c1ccc2c(c1)[C@H]1O[C@@H]2[C@@H]2[C@H]1C[C@@]13CCC1[C@@H]23 |
| InChI | InChI=1S/C16H16O/c1-2-4-9-8(3-1)14-10-7-16-6-5-11(16)13(16)12(10)15(9)17-14/h1-4,10-15H,5-7H2/t10-,11?,12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | IURKRIWOIKSFCF-QCOYFGSJSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |