C17H18F2N2 — CID 107516416
[(2,3-difluoro-4-methylphenyl)-(2,3-dihydro-1H-inden-1-yl)methyl]hydrazine (PubChem CID 107516416) has the molecular formula C17H18F2N2 and a molecular weight of 288.34 g/mol. Its IUPAC name is [(2,3-difluoro-4-methylphenyl)-(2,3-dihydro-1H-inden-1-yl)methyl]hydrazine.
| Compound Name | [(2,3-difluoro-4-methylphenyl)-(2,3-dihydro-1H-inden-1-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107516416 |
| Molecular Formula | C17H18F2N2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(2,3-difluoro-4-methylphenyl)-(2,3-dihydro-1H-inden-1-yl)methyl]hydrazine |
| SMILES | Cc1ccc(C(NN)C2CCc3ccccc32)c(F)c1F |
| InChI | InChI=1S/C17H18F2N2/c1-10-6-8-14(16(19)15(10)18)17(21-20)13-9-7-11-4-2-3-5-12(11)13/h2-6,8,13,17,21H,7,9,20H2,1H3 |
| InChIKey | FUQFYEZLNCPWNF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|