C14H16F2N4 — CID 107516709
[(2,3-difluoro-4-methylphenyl)-(3,6-dimethylpyridazin-4-yl)methyl]hydrazine (PubChem CID 107516709) has the molecular formula C14H16F2N4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(2,3-difluoro-4-methylphenyl)-(3,6-dimethylpyridazin-4-yl)methyl]hydrazine.
| Compound Name | [(2,3-difluoro-4-methylphenyl)-(3,6-dimethylpyridazin-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 107516709 |
| Molecular Formula | C14H16F2N4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2,3-difluoro-4-methylphenyl)-(3,6-dimethylpyridazin-4-yl)methyl]hydrazine |
| SMILES | Cc1cc(C(NN)c2ccc(C)c(F)c2F)c(C)nn1 |
| InChI | InChI=1S/C14H16F2N4/c1-7-4-5-10(13(16)12(7)15)14(18-17)11-6-8(2)19-20-9(11)3/h4-6,14,18H,17H2,1-3H3 |
| InChIKey | YNQWDXVWHZNZAI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|