C10H14N2O2S — CID 10751730
N-(1,2,3,4-tetrahydroisoquinolin-7-yl)methanesulfonamide (PubChem CID 10751730) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydroisoquinolin-7-yl)methanesulfonamide.
| Compound Name | N-(1,2,3,4-tetrahydroisoquinolin-7-yl)methanesulfonamide |
|---|---|
| PubChem CID | 10751730 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-(1,2,3,4-tetrahydroisoquinolin-7-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)CNCC2 |
| InChI | InChI=1S/C10H14N2O2S/c1-15(13,14)12-10-3-2-8-4-5-11-7-9(8)6-10/h2-3,6,11-12H,4-5,7H2,1H3 |
| InChIKey | ZDFDNWSKWRKAEF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |