C11H14BrN5 — CID 107517319
5-(3-bromo-2-pyridinyl)-N,4-diethyl-1,2,4-triazol-3-amine (PubChem CID 107517319) has the molecular formula C11H14BrN5 and a molecular weight of 296.17 g/mol. Its IUPAC name is 5-(3-bromo-2-pyridinyl)-N,4-diethyl-1,2,4-triazol-3-amine.
| Compound Name | 5-(3-bromo-2-pyridinyl)-N,4-diethyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 107517319 |
| Molecular Formula | C11H14BrN5 |
| Molecular Weight | 296.17 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-(3-bromo-2-pyridinyl)-N,4-diethyl-1,2,4-triazol-3-amine |
| SMILES | CCNc1nnc(-c2ncccc2Br)n1CC |
| InChI | InChI=1S/C11H14BrN5/c1-3-13-11-16-15-10(17(11)4-2)9-8(12)6-5-7-14-9/h5-7H,3-4H2,1-2H3,(H,13,16) |
| InChIKey | HDNAHMKGVRYOAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |