C13H26OSi — CID 10751752
4-[(1S,2S)-2-methylcyclopentyl]-1-trimethylsilylbutan-1-one (PubChem CID 10751752) has the molecular formula C13H26OSi and a molecular weight of 226.44 g/mol. Its IUPAC name is 4-[(1S,2S)-2-methylcyclopentyl]-1-trimethylsilylbutan-1-one.
| Compound Name | 4-[(1S,2S)-2-methylcyclopentyl]-1-trimethylsilylbutan-1-one |
|---|---|
| PubChem CID | 10751752 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 4-[(1S,2S)-2-methylcyclopentyl]-1-trimethylsilylbutan-1-one |
| SMILES | C[C@H]1CCC[C@H]1CCCC(=O)[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-11-7-5-8-12(11)9-6-10-13(14)15(2,3)4/h11-12H,5-10H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | JWDDMVDTGSLRRS-RYUDHWBXSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|