C15H17NO — CID 10751779
(3R,5S,8aR)-5-ethenyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 10751779) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is (3R,5S,8aR)-5-ethenyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3R,5S,8aR)-5-ethenyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 10751779 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | (3R,5S,8aR)-5-ethenyl-3-phenyl-3,5,8,8a-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | C=C[C@H]1C=CC[C@H]2OC[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C15H17NO/c1-2-13-9-6-10-15-16(13)14(11-17-15)12-7-4-3-5-8-12/h2-9,13-15H,1,10-11H2/t13-,14-,15+/m0/s1 |
| InChIKey | LWDMYLWPTHPZQD-SOUVJXGZSA-N |
| XLogP | 2.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|