C15H23FN2 — CID 107520014
2-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)ethanamine (PubChem CID 107520014) has the molecular formula C15H23FN2 and a molecular weight of 250.36 g/mol. Its IUPAC name is 2-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)ethanamine.
| Compound Name | 2-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107520014 |
| Molecular Formula | C15H23FN2 |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-(4-ethylpiperidin-1-yl)-1-(4-fluorophenyl)ethanamine |
| SMILES | CCC1CCN(CC(N)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C15H23FN2/c1-2-12-7-9-18(10-8-12)11-15(17)13-3-5-14(16)6-4-13/h3-6,12,15H,2,7-11,17H2,1H3 |
| InChIKey | AWFTWUHXQPCBDB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |