C16H18F2N2O — CID 107520687
1-(3,4-difluorophenyl)-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine (PubChem CID 107520687) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine.
| Compound Name | 1-(3,4-difluorophenyl)-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 107520687 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N'-(4-methoxyphenyl)-N'-methylethane-1,2-diamine |
| SMILES | COc1ccc(N(C)CC(N)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H18F2N2O/c1-20(12-4-6-13(21-2)7-5-12)10-16(19)11-3-8-14(17)15(18)9-11/h3-9,16H,10,19H2,1-2H3 |
| InChIKey | CIENNPKMZNLKMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|