C16H26FN3O — CID 107521195
2-(4-ethyl-3-methylpiperazin-1-yl)-1-(3-fluoro-4-methoxyphenyl)ethanamine (PubChem CID 107521195) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(4-ethyl-3-methylpiperazin-1-yl)-1-(3-fluoro-4-methoxyphenyl)ethanamine.
| Compound Name | 2-(4-ethyl-3-methylpiperazin-1-yl)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 107521195 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-(4-ethyl-3-methylpiperazin-1-yl)-1-(3-fluoro-4-methoxyphenyl)ethanamine |
| SMILES | CCN1CCN(CC(N)c2ccc(OC)c(F)c2)CC1C |
| InChI | InChI=1S/C16H26FN3O/c1-4-20-8-7-19(10-12(20)2)11-15(18)13-5-6-16(21-3)14(17)9-13/h5-6,9,12,15H,4,7-8,10-11,18H2,1-3H3 |
| InChIKey | WIVZNHKWTSNPRW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |