C16H21N3O2 — CID 107522944
[3-(dimethylamino)-4-methylpyrrolidin-1-yl]-[3-(3-hydroxyprop-1-ynyl)-2-pyridinyl]methanone (PubChem CID 107522944) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-[3-(3-hydroxyprop-1-ynyl)-2-pyridinyl]methanone.
| Compound Name | [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-[3-(3-hydroxyprop-1-ynyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 107522944 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [3-(dimethylamino)-4-methylpyrrolidin-1-yl]-[3-(3-hydroxyprop-1-ynyl)-2-pyridinyl]methanone |
| SMILES | CC1CN(C(=O)c2ncccc2C#CCO)CC1N(C)C |
| InChI | InChI=1S/C16H21N3O2/c1-12-10-19(11-14(12)18(2)3)16(21)15-13(7-5-9-20)6-4-8-17-15/h4,6,8,12,14,20H,9-11H2,1-3H3 |
| InChIKey | WODUVQCJBOWYCN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|