C14H20O3 — CID 10752296
(1'S,2'R,5'S,6'S,7'R)-5',7'-dimethylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one (PubChem CID 10752296) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1'S,2'R,5'S,6'S,7'R)-5',7'-dimethylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one.
| Compound Name | (1'S,2'R,5'S,6'S,7'R)-5',7'-dimethylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one |
|---|---|
| PubChem CID | 10752296 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1'S,2'R,5'S,6'S,7'R)-5',7'-dimethylspiro[1,3-dioxolane-2,10'-tricyclo[5.3.0.02,6]decane]-3'-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2[C@H]1[C@@]1(C)CCC3(OCCO3)[C@@H]21 |
| InChI | InChI=1S/C14H20O3/c1-8-7-9(15)10-11(8)13(2)3-4-14(12(10)13)16-5-6-17-14/h8,10-12H,3-7H2,1-2H3/t8-,10+,11-,12-,13+/m0/s1 |
| InChIKey | ATICTPDWETXZSN-XZDSOIIUSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |