C15H18N4O2 — CID 107524071
1-[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 107524071) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 1-[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107524071 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[3-(3-aminoprop-1-ynyl)pyridine-2-carbonyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CNC(=O)C1CCCN1C(=O)c1ncccc1C#CCN |
| InChI | InChI=1S/C15H18N4O2/c1-17-14(20)12-7-4-10-19(12)15(21)13-11(5-2-8-16)6-3-9-18-13/h3,6,9,12H,4,7-8,10,16H2,1H3,(H,17,20) |
| InChIKey | ZFJDZLQMBWKRRV-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|