C17H15N3O — CID 107524277
[3-(3-aminoprop-1-ynyl)-2-pyridinyl]-(1,3-dihydroisoindol-2-yl)methanone (PubChem CID 107524277) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is [3-(3-aminoprop-1-ynyl)-2-pyridinyl]-(1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [3-(3-aminoprop-1-ynyl)-2-pyridinyl]-(1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 107524277 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | [3-(3-aminoprop-1-ynyl)-2-pyridinyl]-(1,3-dihydroisoindol-2-yl)methanone |
| SMILES | NCC#Cc1cccnc1C(=O)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C17H15N3O/c18-9-3-7-13-8-4-10-19-16(13)17(21)20-11-14-5-1-2-6-15(14)12-20/h1-2,4-6,8,10H,9,11-12,18H2 |
| InChIKey | SAFRUUPFXAAIGN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|