C15H26O2 — CID 10752444
(4S)-4-[(1Z,4Z)-deca-1,4-dienyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 10752444) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (4S)-4-[(1Z,4Z)-deca-1,4-dienyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(1Z,4Z)-deca-1,4-dienyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 10752444 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (4S)-4-[(1Z,4Z)-deca-1,4-dienyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCCCC/C=C\C/C=C\[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H26O2/c1-4-5-6-7-8-9-10-11-12-14-13-16-15(2,3)17-14/h8-9,11-12,14H,4-7,10,13H2,1-3H3/b9-8-,12-11-/t14-/m0/s1 |
| InChIKey | GLJMPNDAPITFBD-ROLKAOPOSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|