C23H16Cl2N2O3 — CID 1075248
(4Z)-1-(3,4-dichlorophenyl)-4-[(3-phenylmethoxyphenyl)methylidene]pyrazolidine-3,5-dione (PubChem CID 1075248) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is (4Z)-1-(3,4-dichlorophenyl)-4-[(3-phenylmethoxyphenyl)methylidene]pyrazolidine-3,5-dione.
| Compound Name | (4Z)-1-(3,4-dichlorophenyl)-4-[(3-phenylmethoxyphenyl)methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 1075248 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | (4Z)-1-(3,4-dichlorophenyl)-4-[(3-phenylmethoxyphenyl)methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(Cl)c(Cl)c2)C(=O)/C1=C\c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c24-20-10-9-17(13-21(20)25)27-23(29)19(22(28)26-27)12-16-7-4-8-18(11-16)30-14-15-5-2-1-3-6-15/h1-13H,14H2,(H,26,28)/b19-12- |
| InChIKey | OSJPWEILZQFNPI-UNOMPAQXSA-N |
| XLogP | 5.03 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|