C15H21F2NS — CID 107525018
1-(3,4-difluorophenyl)-2-(3-methylcyclohexyl)sulfanylethanamine (PubChem CID 107525018) has the molecular formula C15H21F2NS and a molecular weight of 285.40 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-2-(3-methylcyclohexyl)sulfanylethanamine.
| Compound Name | 1-(3,4-difluorophenyl)-2-(3-methylcyclohexyl)sulfanylethanamine |
|---|---|
| PubChem CID | 107525018 |
| Molecular Formula | C15H21F2NS |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-(3,4-difluorophenyl)-2-(3-methylcyclohexyl)sulfanylethanamine |
| SMILES | CC1CCCC(SCC(N)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C15H21F2NS/c1-10-3-2-4-12(7-10)19-9-15(18)11-5-6-13(16)14(17)8-11/h5-6,8,10,12,15H,2-4,7,9,18H2,1H3 |
| InChIKey | XHSFRCDJJDXBHD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |