C12H15BrN4O2 — CID 107525417
1-(3-bromopyridine-2-carbonyl)-N'-hydroxypiperidine-3-carboximidamide (PubChem CID 107525417) has the molecular formula C12H15BrN4O2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 1-(3-bromopyridine-2-carbonyl)-N'-hydroxypiperidine-3-carboximidamide.
| Compound Name | 1-(3-bromopyridine-2-carbonyl)-N'-hydroxypiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 107525417 |
| Molecular Formula | C12H15BrN4O2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 1-(3-bromopyridine-2-carbonyl)-N'-hydroxypiperidine-3-carboximidamide |
| SMILES | N/C(=N/O)C1CCCN(C(=O)c2ncccc2Br)C1 |
| InChI | InChI=1S/C12H15BrN4O2/c13-9-4-1-5-15-10(9)12(18)17-6-2-3-8(7-17)11(14)16-19/h1,4-5,8,19H,2-3,6-7H2,(H2,14,16) |
| InChIKey | YNUINBZTXDQVMJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|