C14H18N2O4S — CID 107526045
(E)-3-[2-(3-methylsulfinylbutylcarbamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 107526045) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is (E)-3-[2-(3-methylsulfinylbutylcarbamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-methylsulfinylbutylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107526045 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (E)-3-[2-(3-methylsulfinylbutylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CC(CCNC(=O)c1ncccc1/C=C/C(=O)O)S(C)=O |
| InChI | InChI=1S/C14H18N2O4S/c1-10(21(2)20)7-9-16-14(19)13-11(4-3-8-15-13)5-6-12(17)18/h3-6,8,10H,7,9H2,1-2H3,(H,16,19)(H,17,18)/b6-5+ |
| InChIKey | UIFNMHVZXVBVAH-AATRIKPKSA-N |
| XLogP | 1.07 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|